For research use only. Not for therapeutic Use.
4-isocyanato-3,4-dihydro-2H-1-benzopyran(Cat No.:L007646), is a chemical compound characterized by a dihydro-2H-1-benzopyran core with an isocyanato group at the 4-position. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers use it as a key intermediate for the creation of diverse organic molecules, especially in the development of pharmaceuticals and fine chemicals.
Catalog Number | L007646 |
CAS Number | 1333810-95-9 |
Molecular Formula | C10H9NO2 |
Purity | ≥95% |
IUPAC Name | 4-isocyanato-3,4-dihydro-2H-chromene |
InChI | InChI=1S/C10H9NO2/c12-7-11-9-5-6-13-10-4-2-1-3-8(9)10/h1-4,9H,5-6H2 |
InChIKey | AXOVCCFEDUFHIU-UHFFFAOYSA-N |
SMILES | C1COC2=CC=CC=C2C1N=C=O |