For research use only. Not for therapeutic Use.
4-(Isonicotinoyloxy)phenyl isonicotinate (Cat.No:L003891) is a vital compound in pharmaceutical research. Its distinct structure incorporates isonicotinoyloxy and phenyl isonicotinate moieties, offering unique reactivity. This compound plays a key role in the development of specialized pharmaceutical agents, particularly in drug delivery systems.
| Catalog Number | L003891 |
| CAS Number | 154306-50-0 |
| Molecular Formula | C18H12N2O4 |
| Purity | ≥95% |
| IUPAC Name | [4-(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate |
| InChI | InChI=1S/C18H12N2O4/c21-17(13-5-9-19-10-6-13)23-15-1-2-16(4-3-15)24-18(22)14-7-11-20-12-8-14/h1-12H |
| InChIKey | LGZPECRBROJIHY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC(=O)C2=CC=NC=C2)OC(=O)C3=CC=NC=C3 |
