For research use only. Not for therapeutic Use.
4-Isopropoxy-1H-pyrrolo[2,3-b]pyridine(CAT: L035246) is a heterocyclic compound featuring an isopropoxy group attached to a pyrrolopyridine core, making it useful in medicinal chemistry as a scaffold for synthesizing bioactive molecules. The pyrrolopyridine structure is commonly employed in the development of kinase inhibitors and other therapeutic agents, especially in oncology and inflammatory diseases. The isopropoxy substitution enhances its lipophilicity, potentially improving membrane permeability and bioavailability in drug candidates. 4-Isopropoxy-1H-pyrrolo[2,3-b]pyridine is a valuable intermediate, supporting the design of complex pharmacophores in drug discovery and development.
CAS Number | 937797-32-5 |
Molecular Formula | C10H12N2O |
Purity | ≥95% |
IUPAC Name | 4-propan-2-yloxy-1H-pyrrolo[2,3-b]pyridine |
InChI | InChI=1S/C10H12N2O/c1-7(2)13-9-4-6-12-10-8(9)3-5-11-10/h3-7H,1-2H3,(H,11,12) |
InChIKey | IVZVJMGDWGICPC-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |