For research use only. Not for therapeutic Use.
4-Isopropoxybenzoyl chloride（Cat No.:L006864）, is a chemical compound widely used in organic synthesis and pharmaceutical research. Its molecular structure includes a benzoyl chloride group with an isopropoxy (2-propoxy) substituent at the 4th position of the benzene ring. This compound serves as a versatile reagent for the introduction of the benzoyl group into various organic molecules. Chemists utilize it in the preparation of intermediates for pharmaceuticals, agrochemicals, and specialty chemicals.
| Catalog Number | L006864 |
| CAS Number | 36823-82-2 |
| Molecular Formula | C10H11ClO2 |
| Purity | ≥95% |
| IUPAC Name | 4-propan-2-yloxybenzoyl chloride |
| InChI | InChI=1S/C10H11ClO2/c1-7(2)13-9-5-3-8(4-6-9)10(11)12/h3-7H,1-2H3 |
| InChIKey | USRKDQLKRQMYKX-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=C(C=C1)C(=O)Cl |
