For research use only. Not for therapeutic Use.
4-Isopropoxyphenylboronic Acid is a key organoboron compound utilized in organic synthesis and medicinal chemistry. This boronic acid features an isopropoxy group, enhancing its solubility and reactivity. It serves as an important reagent in Suzuki-Miyaura cross-coupling reactions, facilitating the formation of carbon-carbon bonds. Its ability to form stable complexes with diols makes it valuable in the development of sensors and drug delivery systems. The unique properties of 4-Isopropoxyphenylboronic Acid make it essential for advancing synthetic methodologies and biomedical applications.
CAS Number | 153624-46-5 |
Synonyms | [4-(1-Methylethoxy)phenyl]-boronic Acid; (4-Isopropyloxyphenyl)boronic Acid; 4-Isopropoxybenzeneboronic Acid; 4-Isopropoxyphenylboronic Acid; [4-(1-Methylethoxy)phenyl]boronic Acid |
Molecular Formula | C9H13BO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (4-propan-2-yloxyphenyl)boronic acid |
InChI | InChI=1S/C9H13BO3/c1-7(2)13-9-5-3-8(4-6-9)10(11)12/h3-7,11-12H,1-2H3 |
InChIKey | CJUHQADBFQRIMC-UHFFFAOYSA-N |
SMILES | B(C1=CC=C(C=C1)OC(C)C)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |