For research use only. Not for therapeutic Use.
4-Isothiocyanatophenol is a versatile chemical used in organic synthesis for introducing the isothiocyanate functional group into molecules. This compound finds applications in medicinal chemistry, particularly in the synthesis of bioconjugates and pharmaceutical intermediates. Its reactivity and ability to form stable linkages with biomolecules make it valuable in drug discovery and development processes, including antibody labeling and protein modification.
| Catalog Number | R072234 |
| CAS Number | 2131-60-4 |
| Synonyms | 4-Isothiocyanatophenol, 4-Hydroxyphenylisothiocyanate |
| Molecular Formula | C7H5NOS |
| Purity | 99% |
| Appearance | Pale yellow needles |
| IUPAC Name | 4-isothiocyanatophenol |
| InChI | InChI=1S/C7H5NOS/c9-7-3-1-6(2-4-7)8-5-10/h1-4,9H |
| InChIKey | HIPHYBWWZWRZOV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=C=S)O |
