For research use only. Not for therapeutic Use.
4-Mercapto-O-cresol is an aromatic thiol compound used in chemical research and industrial applications. Characterized by a mercapto group and a methyl substituent on the aromatic ring, this compound exhibits strong nucleophilic properties, making it useful in various organic reactions, including thiol-ene and thiol-Michael additions. It serves as a valuable reagent in synthesizing organosulfur compounds and can act as a stabilizer in polymer formulations. Additionally, 4-mercapto-O-cresol is explored for its potential antioxidant properties in biological systems.
| CAS Number | 32281-01-9 |
| Synonyms | 4-Mercapto-2-methylphenol; |
| Molecular Formula | C7H8OS |
| Purity | 90% |
| Appearance | White to Yellow Solid |
| Storage | Store at -20°C |
| IUPAC Name | 2-methyl-4-sulfanylphenol |
| InChI | InChI=1S/C7H8OS/c1-5-4-6(9)2-3-7(5)8/h2-4,8-9H,1H3 |
| InChIKey | UMJGOCMSBZWCNY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)S)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
