For research use only. Not for therapeutic Use.
4-Mercaptobenzaldehyde(CAT: R058856) is a chemical compound used primarily in organic chemistry. Its action method involves its use as a reagent or intermediate in the synthesis of various organic molecules. Compounds like 4-Mercaptobenzaldehyde are often employed in organic synthesis to introduce specific structural features or functional groups into molecules, potentially influencing their properties and functions.
CAS Number | 91358-96-2 |
Synonyms | Formylbenzenethiol; p-Mercaptobenzaldehyde |
Molecular Formula | C7H6OS |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | 4-sulfanylbenzaldehyde |
InChI | InChI=1S/C7H6OS/c8-5-6-1-3-7(9)4-2-6/h1-5,9H |
InChIKey | NRLPPGBADQVXSJ-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C=O)S |