For research use only. Not for therapeutic Use.
4-Mercaptomethyl Dipicolinic Acid (4-MMDPA)(CAT: R013647) is a derivative of dipicolinic acid, featuring a thiol group (-SH) attached to the methyl position. This compound is of interest in coordination chemistry and biochemical research due to its ability to bind metal ions. The thiol group provides an additional site for metal chelation, enhancing its utility in complexation with heavy metals and in catalysis. 4-MMDPA may also be applied in studying enzyme-active sites and metal-based drug delivery systems. Its unique structure makes it a valuable tool for exploring metal-ligand interactions, potentially contributing to advancements in materials science and environmental chemistry.
| Catalog Number | R013647 |
| CAS Number | 1040401-18-0 |
| Synonyms | 4-(Mercaptomethyl)-2,6-pyridinedicarboxylic Acid; 4-MMDPA; |
| Molecular Formula | C8H7NO4S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-(sulfanylmethyl)pyridine-2,6-dicarboxylic acid |
| InChI | InChI=1S/C8H7NO4S/c10-7(11)5-1-4(3-14)2-6(9-5)8(12)13/h1-2,14H,3H2,(H,10,11)(H,12,13) |
| InChIKey | WSVZILXOOFJPGD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1C(=O)O)C(=O)O)CS |
