For research use only. Not for therapeutic Use.
4-Methoxy-2-(trifluoromethoxy)benzonitrile(CAT: L023510) is an aromatic compound featuring a methoxy group at the 4-position, a trifluoromethoxy group at the 2-position, and a nitrile group on a benzene ring. This compound is widely utilized in pharmaceutical and chemical research as a versatile intermediate for synthesizing bioactive molecules, including potential drug candidates. Its electron-withdrawing trifluoromethoxy and nitrile groups enhance its reactivity, making it suitable for various functionalization reactions. With high purity and excellent stability, 4-Methoxy-2-(trifluoromethoxy)benzonitrile is a reliable building block for advanced organic synthesis and innovative drug discovery applications.
CAS Number | 886502-33-6 |
Molecular Formula | C9H6F3NO2 |
Purity | ≥95% |
IUPAC Name | 4-methoxy-2-(trifluoromethoxy)benzonitrile |
InChI | InChI=1S/C9H6F3NO2/c1-14-7-3-2-6(5-13)8(4-7)15-9(10,11)12/h2-4H,1H3 |
InChIKey | KCDAVWNDFNGBFU-UHFFFAOYSA-N |
SMILES | COC1=CC(=C(C=C1)C#N)OC(F)(F)F |