For research use only. Not for therapeutic Use.
4-Methoxy-3-methylphenylacetone(Cat No.:M080396), also known as p-acetylacetone, is a chemical compound with the molecular formula C11H14O2. It features a phenyl ring substituted with a methoxy group at the 4-position and a methyl group at the 3-position, linked to an acetone group. This structure belongs to the ketone family, particularly aromatic ketones, which are known for their distinct smells and are commonly used in the fragrance and flavor industries. The presence of the methoxy and methyl groups also suggests potential uses in organic synthesis, providing pathways for further chemical modifications.
CAS Number | 16882-23-8 |
Synonyms | 4-METHOXY-3-METHYLPHENYLACETONE |
Molecular Formula | C11H14O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-(4-methoxy-3-methylphenyl)propan-2-one |
InChI | InChI=1S/C11H14O2/c1-8-6-10(7-9(2)12)4-5-11(8)13-3/h4-6H,7H2,1-3H3 |
InChIKey | QSBPLIJLGSKDTH-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC(=C1)CC(=O)C)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |