For research use only. Not for therapeutic Use.
4-Methoxy-4′-trifluoromethylbenzophenone is an aromatic ketone with a benzophenone core, where one phenyl ring is substituted with a methoxy group at the 4-position and the other with a trifluoromethyl group at the 4′-position. The methoxy group imparts electron-donating characteristics, while the trifluoromethyl group is strongly electron-withdrawing, creating a balance of electronic effects that influences reactivity. This compound is useful in synthetic organic chemistry, particularly in pharmaceutical and materials applications, where such functionalized ketones serve as intermediates in creating complex molecules.
CAS Number | 6185-76-8 |
Molecular Formula | C15H11F3O2 |
Purity | ≥95% |
IUPAC Name | (4-methoxyphenyl)-[4-(trifluoromethyl)phenyl]methanone |
InChI | InChI=1S/C15H11F3O2/c1-20-13-8-4-11(5-9-13)14(19)10-2-6-12(7-3-10)15(16,17)18/h2-9H,1H3 |
InChIKey | IDGRRJWQDJEWGN-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)C(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |