For research use only. Not for therapeutic Use.
4-Methoxy-7H-pyrrolo[2,3-d]pyrimidin-2-amine(Cat No.:L006776). It is a heterocyclic compound containing a pyrrole-pyrimidine backbone substituted with a methoxy group at the 4-position. This compound is significant in medicinal chemistry and drug discovery research, often used as a scaffold for the design of kinase inhibitors and potential anticancer agents. Its unique structure makes it valuable for creating diverse bioactive molecules. Researchers utilize it as a core template to synthesize novel compounds, exploring their potential pharmacological activities and contributing to the development of new drugs and therapeutic interventions.
Catalog Number | L006776 |
CAS Number | 84955-32-8 |
Molecular Formula | C7H8N4O |
Purity | ≥95% |
IUPAC Name | 4-methoxy-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
InChI | InChI=1S/C7H8N4O/c1-12-6-4-2-3-9-5(4)10-7(8)11-6/h2-3H,1H3,(H3,8,9,10,11) |
InChIKey | CNPURSDMOWDNOQ-UHFFFAOYSA-N |
SMILES | COC1=NC(=NC2=C1C=CN2)N |