For research use only. Not for therapeutic Use.
4-Methoxy-N-(p-tolyl)aniline(Cat No.:L021998)is an aromatic amine used in pharmaceutical and chemical research. This compound features a methoxy group at the 4-position of the aniline ring and a p-tolyl group attached to the nitrogen atom. Its structure makes it a valuable intermediate in the synthesis of dyes, pigments, and various bioactive molecules. It is particularly useful in developing therapeutic agents targeting inflammatory conditions and other diseases. The compound’s stability and reactivity make 4-Methoxy-N-(p-tolyl)aniline an essential tool for medicinal chemists and material scientists.
CAS Number | 39253-43-5 |
Molecular Formula | C14H15NO |
Purity | ≥95% |
IUPAC Name | N-(4-methoxyphenyl)-4-methylaniline |
InChI | InChI=1S/C14H15NO/c1-11-3-5-12(6-4-11)15-13-7-9-14(16-2)10-8-13/h3-10,15H,1-2H3 |
InChIKey | KIDXWDVZFZMXGM-UHFFFAOYSA-N |
SMILES | CC1=CC=C(C=C1)NC2=CC=C(C=C2)OC |