For research use only. Not for therapeutic Use.
4-methoxybenzo[d]oxazol-2(3H)-one (Cat.No:L003659) is a significant chemical compound with versatile applications in pharmaceutical and agrochemical industries. Its distinctive oxazolone ring structure imparts valuable pharmacological properties. This compound serves as a crucial building block in the synthesis of various bioactive molecules, highlighting its importance in drug discovery. Additionally, its presence in agrochemical research underscores its relevance in the development of innovative solutions for crop protection.
Catalog Number | L003659 |
CAS Number | 40925-62-0 |
Molecular Formula | C8H7NO3 |
Purity | ≥95% |
IUPAC Name | 4-methoxy-3H-1,3-benzoxazol-2-one |
InChI | InChI=1S/C8H7NO3/c1-11-5-3-2-4-6-7(5)9-8(10)12-6/h2-4H,1H3,(H,9,10) |
InChIKey | WHLOSPLLWFJNJL-UHFFFAOYSA-N |
SMILES | COC1=CC=CC2=C1NC(=O)O2 |