For research use only. Not for therapeutic Use.
4-Methoxybenzo[d]thiazole-2-carbonitrile(CAT: L039858) is a heterocyclic compound featuring a benzo[d]thiazole core with a methoxy group at the 4-position and a carbonitrile group at the 2-position. This compound is widely utilized in pharmaceutical and synthetic chemistry as a versatile intermediate for the development of bioactive molecules. Its unique combination of functional groups allows for diverse chemical transformations, including nucleophilic substitution and condensation reactions, making it valuable in the synthesis of therapeutic agents such as kinase inhibitors and antimicrobial compounds. Researchers leverage 4-Methoxybenzo[d]thiazole-2-carbonitrile in structure-activity relationship (SAR) studies and drug discovery to create novel and effective pharmaceutical agents.
CAS Number | 7267-30-3 |
Molecular Formula | C9H6N2OS |
Purity | ≥95% |
IUPAC Name | 4-methoxy-1,3-benzothiazole-2-carbonitrile |
InChI | InChI=1S/C9H6N2OS/c1-12-6-3-2-4-7-9(6)11-8(5-10)13-7/h2-4H,1H3 |
InChIKey | NNVOWTIUIOZIKH-UHFFFAOYSA-N |
SMILES | COC1=C2C(=CC=C1)SC(=N2)C#N |