For research use only. Not for therapeutic Use.
4-Methoxycinnamaldehyde(Cat No.:M122828)is a naturally occurring compound found in various plants, particularly in cinnamon. It is a derivative of cinnamaldehyde with a methoxy group at the para-position of the benzene ring. This compound exhibits antioxidant, anti-inflammatory, and antimicrobial properties, making it valuable in both pharmaceutical and cosmetic formulations. Additionally, 4-Methoxycinnamaldehyde has demonstrated potential in modulating cellular signaling pathways, including those involved in oxidative stress and inflammation, offering a promising avenue for the development of therapeutic agents targeting inflammatory and oxidative diseases. It also serves as a flavoring and fragrance agent in food and personal care products.
CAS Number | 1963-36-6 |
Molecular Formula | C10H10O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (E)-3-(4-methoxyphenyl)prop-2-enal |
InChI | InChI=1S/C10H10O2/c1-12-10-6-4-9(5-7-10)3-2-8-11/h2-8H,1H3/b3-2+ |
InChIKey | AXCXHFKZHDEKTP-NSCUHMNNSA-N |
SMILES | COC1=CC=C(C=C1)/C=C/C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |