For research use only. Not for therapeutic Use.
4′-Methoxyflavonol is a synthesized flavone/flavonol with 1, 2-dipalmitoyl-sn-glycero-3-phosphocholine (DPPC) bilayers[1].
| Catalog Number | I019380 |
| CAS Number | 6889-78-7 |
| Synonyms | 3-hydroxy-2-(4-methoxyphenyl)chromen-4-one |
| Molecular Formula | C16H12O4 |
| Purity | ≥95% |
| InChI | InChI=1S/C16H12O4/c1-19-11-8-6-10(7-9-11)16-15(18)14(17)12-4-2-3-5-13(12)20-16/h2-9,18H,1H3 |
| InChIKey | IIBBFGMVMNZMGA-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C(=O)C3=CC=CC=C3O2)O |
| Reference | [1]. Islam MT. Variation in chemotactic preferences of Aphanomyces cochlioides zoospores to flavonoids. Z Naturforsch C. 2009 Nov-Dec;64(11-12):847-52. |
