For research use only. Not for therapeutic Use.
4-Methoxynicotinamide(Cat No.:L035640)is a derivative of nicotinamide, known for its role in biochemical and pharmaceutical research. This compound, featuring a methoxy group at the 4-position of the nicotinamide ring, is of interest for its potential biological activities, including anti-inflammatory and neuroprotective effects. It is commonly used in studies exploring NAD+ metabolism, cellular energy balance, and the development of new therapeutic agents. With its unique structure, 4-Methoxynicotinamide serves as a valuable tool in the investigation of metabolic pathways and drug discovery processes.
CAS Number | 7418-64-6 |
Molecular Formula | C7H8N2O2 |
Purity | ≥95% |
IUPAC Name | 4-methoxypyridine-3-carboxamide |
InChI | InChI=1S/C7H8N2O2/c1-11-6-2-3-9-4-5(6)7(8)10/h2-4H,1H3,(H2,8,10) |
InChIKey | NXQLBCIJYNCZKC-UHFFFAOYSA-N |
SMILES | COC1=C(C=NC=C1)C(=O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |