For research use only. Not for therapeutic Use.
4-Methyl-1-phenyl-2-pentanone(Cat No.:R035789)is a specialized ketone compound characterized by a phenyl group and a methyl group attached to a pentanone backbone. This structure makes it a versatile intermediate in the synthesis of fragrances, pharmaceuticals, and organic compounds. Its ketonic group allows for various chemical reactions, including condensations and reductions, essential in creating complex molecular architectures. Its utility extends to the production of fine chemicals and potential precursors for active pharmaceutical ingredients, where the phenyl and methyl modifications play crucial roles in determining the final product’s chemical properties and reactivity.
CAS Number | 5349-62-2 |
Synonyms | Benzyl Isobutyl Ketone; Isobutyl Benzyl Ketone; NSC 1268; |
Molecular Formula | C12H16O |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | 4-methyl-1-phenylpentan-2-one |
InChI | InChI=1S/C12H16O/c1-10(2)8-12(13)9-11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 |
InChIKey | DTYGTEGDVPAKDA-UHFFFAOYSA-N |
SMILES | CC(C)CC(=O)CC1=CC=CC=C1 |