Home
>
Chemical Reagents> 4-methyl-1-(tetrahydro-2H-pyran-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
For research use only. Not for therapeutic Use.
4-Methyl-1-(tetrahydro-2H-pyran-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole(Cat No.:L025469)is a complex organic compound used in pharmaceutical and chemical research. This molecule features a pyrazole ring with a methyl group, a tetrahydropyran moiety, and a dioxaborolane group, making it a versatile intermediate in synthesizing various bioactive molecules. It is particularly valuable in drug discovery efforts, especially in developing potential therapeutic agents for cancer and neurological disorders. The unique combination of functional groups in 4-Methyl-1-(tetrahydro-2H-pyran-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole enhances its reactivity, making it essential for medicinal chemistry.
Catalog Number | L025469 |
CAS Number | 1492954-33-2 |
Molecular Formula | C15H25BN2O3 |
Purity | ≥95% |
IUPAC Name | 4-methyl-1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
InChI | InChI=1S/C15H25BN2O3/c1-11-10-17-18(12-8-6-7-9-19-12)13(11)16-20-14(2,3)15(4,5)21-16/h10,12H,6-9H2,1-5H3 |
InChIKey | JUCGITVYAKQXHE-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=NN2C3CCCCO3)C |