For research use only. Not for therapeutic Use.
4-Methyl-3,4-dihydro-2H-1,4-benzoxazin-6-amine(Cat No.:L007168), is a chemical compound. It features a benzoxazine ring—a six-membered heterocyclic structure—substituted with an amino group (-NH2) at the 6th position and a methyl group (-CH3) at the 4th position. This compound is significant in medicinal chemistry and drug discovery research, often utilized as a valuable building block for the synthesis of various bioactive molecules and pharmaceuticals. Its unique structure and reactivity make it versatile for creating diverse organic compounds, contributing to the development of potential therapeutic agents and advancements in medicinal chemistry research.
CAS Number | 226571-61-5 |
Molecular Formula | C9H12N2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-methyl-2,3-dihydro-1,4-benzoxazin-6-amine |
InChI | InChI=1S/C9H12N2O/c1-11-4-5-12-9-3-2-7(10)6-8(9)11/h2-3,6H,4-5,10H2,1H3 |
InChIKey | ZTBQQMRMUWBAOB-UHFFFAOYSA-N |
SMILES | CN1CCOC2=C1C=C(C=C2)N |