For research use only. Not for therapeutic Use.
4-Methyl-4′-pentyl-1,1′-biphenyl(Cat No.:L011014)is a high-purity biphenyl derivative commonly used in materials science and organic synthesis. Featuring a methyl group at the 4-position and a pentyl chain at the 4′-position, this compound is essential for developing liquid crystals and other advanced materials. Its unique structure provides desirable properties, making it valuable for applications in display technologies and electronic devices. 4-Methyl-4′-pentyl-1,1′-biphenyl ensures consistent performance and reliability, serving as a crucial building block in the synthesis of functional organic materials.
Catalog Number | L011014 |
CAS Number | 64835-63-8 |
Molecular Formula | C18H22 |
Purity | ≥95% |
IUPAC Name | 1-methyl-4-(4-pentylphenyl)benzene |
InChI | InChI=1S/C18H22/c1-3-4-5-6-16-9-13-18(14-10-16)17-11-7-15(2)8-12-17/h7-14H,3-6H2,1-2H3 |
InChIKey | ZGBOHJUSTPZQPL-UHFFFAOYSA-N |
SMILES | CCCCCC1=CC=C(C=C1)C2=CC=C(C=C2)C |