For research use only. Not for therapeutic Use.
4-Methyl-5-thiazoleethanol(Cat No.:R018767)is a thiazole derivative characterized by a methyl group and an ethanol side chain attached to its heterocyclic sulfur-containing ring. This compound is crucial in the synthesis of pharmaceuticals and agrochemicals, offering properties that enhance biological activity and solubility. The thiazole ring provides a core structure that is fundamental in many drugs and functional materials due to its ability to interact with various biological targets. 4-Methyl-5-thiazoleethanol is particularly useful in creating molecules with antifungal and antibacterial properties, contributing significantly to the development of new therapeutic agents.
CAS Number | 137-00-8 |
Synonyms | 2-(4-Methyl-1,3-thiazol-5-yl)ethanol; 2-(4-Methyl-5-thiazolyl)ethanol; 2-(4-Methylthiazole-5-yl)ethanol; 4-Methyl-5-(2-hydroxyethyl)thiazole; 4-Methyl-5-(2-thiazoleethanol); 4-Methyl-5-(β-hydroxyethyl)thiazole; 4-Methyl-5-thiazoleethanol; 4-Methyl-5- |
Molecular Formula | C6H9NOS |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | Store at -20°C |
IUPAC Name | 2-(4-methyl-1,3-thiazol-5-yl)ethanol |
InChI | InChI=1S/C6H9NOS/c1-5-6(2-3-8)9-4-7-5/h4,8H,2-3H2,1H3 |
InChIKey | BKAWJIRCKVUVED-UHFFFAOYSA-N |
SMILES | CC1=C(SC=N1)CCO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |