For research use only. Not for therapeutic Use.
4-Methyl-6-propoxypyridin-3-amine(Cat No.:L007692), is a chemical compound featuring a pyridine ring substituted with a methyl group at the 4-position and a propoxy group at the 6-position, with an amino group at the 3-position. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers utilize it as a crucial intermediate in creating diverse organic molecules, especially in developing pharmaceuticals and agrochemicals.
Catalog Number | L007692 |
CAS Number | 1540599-32-3 |
Molecular Formula | C9H14N2O |
Purity | ≥95% |
IUPAC Name | 4-methyl-6-propoxypyridin-3-amine |
InChI | InChI=1S/C9H14N2O/c1-3-4-12-9-5-7(2)8(10)6-11-9/h5-6H,3-4,10H2,1-2H3 |
InChIKey | RQIWJHSBFBRUGN-UHFFFAOYSA-N |
SMILES | CCCOC1=NC=C(C(=C1)C)N |