For research use only. Not for therapeutic Use.
4-Methyl-isophthalonitrile(Cat No.:M123633)is a nitrile-functionalized aromatic compound, distinguished by a methyl group on an isophthalic acid derivative. It plays a critical role in polymer science, particularly in the synthesis of high-performance polymers and resins, due to its ability to undergo polymerization reactions that enhance thermal stability and chemical resistance. Additionally, its nitrile groups can be transformed into other functional groups, broadening its utility in creating more complex organic molecules. This compound is also essential in the production of dyes, pharmaceuticals, and agrochemicals, where it contributes to the development of novel materials with enhanced properties.
Catalog Number | M123633 |
CAS Number | 1943-88-0 |
Synonyms | 4-METHYL-ISOPHTHALONITRILE |
Molecular Formula | C9H6N2 |
Purity | ≥95% |
IUPAC Name | 4-methylbenzene-1,3-dicarbonitrile |
InChI | InChI=1S/C9H6N2/c1-7-2-3-8(5-10)4-9(7)6-11/h2-4H,1H3 |
InChIKey | KWSRDTCYJMRAAD-UHFFFAOYSA-N |
SMILES | CC1=C(C=C(C=C1)C#N)C#N |