For research use only. Not for therapeutic Use.
4-(Methylamino)-3-nitrobenzoyl Chloride(Cat No.:L007060), is a chemical compound used in organic synthesis as a key intermediate. This compound features a benzoyl chloride functional group (-COCl) attached to a 4-(methylamino)-3-nitrobenzene ring. Its reactivity arises from the presence of both a nitro group (-NO2) and an amino group (-NHCH3), making it valuable in the preparation of various organic compounds, such as pharmaceuticals and agrochemicals. As a versatile reagent, it participates in reactions like amide formation and nucleophilic substitution, allowing chemists to create diverse and complex molecules for research and industrial applications, contributing significantly to the field of organic chemistry.
CAS Number | 82357-48-0 |
Molecular Formula | C8H7ClN2O3 |
Purity | ≥95% |
IUPAC Name | 4-(methylamino)-3-nitrobenzoyl chloride |
InChI | InChI=1S/C8H7ClN2O3/c1-10-6-3-2-5(8(9)12)4-7(6)11(13)14/h2-4,10H,1H3 |
InChIKey | LIRZLGQEZXAOQR-UHFFFAOYSA-N |
SMILES | CNC1=C(C=C(C=C1)C(=O)Cl)[N+](=O)[O-] |