For research use only. Not for therapeutic Use.
4-(Methylamino)benzenethiol（Cat No.:L007656）, is a chemical compound featuring a benzene ring substituted with a thiol group at the 4-position and a methylamino group at the para-position. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers utilize it as a valuable intermediate in the creation of diverse organic molecules, especially in the development of pharmaceuticals and fine chemicals.
| Catalog Number | L007656 |
| CAS Number | 4946-21-8 |
| Molecular Formula | C7H9NS |
| Purity | ≥95% |
| IUPAC Name | 4-(methylamino)benzenethiol |
| InChI | InChI=1S/C7H9NS/c1-8-6-2-4-7(9)5-3-6/h2-5,8-9H,1H3 |
| InChIKey | FEIHCAFTYDPAHR-UHFFFAOYSA-N |
| SMILES | CNC1=CC=C(C=C1)S |
