For research use only. Not for therapeutic Use.
(4-Methylbenzyl) triphenylphosphonium Bromide (Cat. No: R021218) is an organophosphine compound that can be used for drug preparation in the fine chemical industry, mainly for scientific research.
| Catalog Number | R021218 |
| CAS Number | 2378-86-1 |
| Synonyms | (p-Methylbenzyl)triphenylphosphonium Bromide; [(4-Methylphenyl)methyl]triphenylphosphonium Bromide; NSC 77141 |
| Molecular Formula | C26H24BrP |
| Purity | ≥95% |
| Storage | Store at -20C |
| IUPAC Name | (4-methylphenyl)methyl-triphenylphosphanium;bromide |
| InChI | InChI=1S/C26H24P.BrH/c1-22-17-19-23(20-18-22)21-27(24-11-5-2-6-12-24,25-13-7-3-8-14-25)26-15-9-4-10-16-26;/h2-20H,21H2,1H3;1H/q+1;/p-1 |
| InChIKey | CEEKCHGNKYVTTM-UHFFFAOYSA-M |
| SMILES | CC1=CC=C(C=C1)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Br-] |
