For research use only. Not for therapeutic Use.
4-Methylcyclohexanemethanol-d3(Cat No.:R043998) is a high-purity deuterated compound featuring three deuterium atoms, essential for advanced pharmaceutical and biochemical research. This isotopically labeled version of 4-methylcyclohexanemethanol is crucial for studying its metabolic pathways, chemical reactivity, and environmental impact. Its stable isotope labeling ensures precise and reliable analytical results, making it ideal for applications in NMR spectroscopy, mass spectrometry, and toxicological studies. The enhanced stability and consistency of 4-methylcyclohexanemethanol-d3 make it suitable for various experimental setups, offering a robust and cost-effective solution for high-precision scientific investigations.
CAS Number | NA |
Synonyms | 4-Methyl-cyclohexanemethanol-d3; (4-Methylcyclohexyl)methanol-d3; 4-Methylcyclohexane methanol-d3; Hexahydro-p-methylbenzyl alcohol-d3 |
Molecular Formula | C₈H₁₃D₃O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | dideuterio-(1-deuterio-4-methylcyclohexyl)methanol |
InChI | InChI=1S/C8H16O/c1-7-2-4-8(6-9)5-3-7/h7-9H,2-6H2,1H3/i6D2,8D |
InChIKey | OSINZLLLLCUKJH-OJYSAGIRSA-N |
SMILES | [2H]C1(CCC(CC1)C)C([2H])([2H])O |