For research use only. Not for therapeutic Use.
4-Methyldaphnetin(Cat No.:R072391) serves as a precursor for the synthesis of 4-methyl coumarin derivatives. It exhibits notable and selective anti-proliferation properties and induces apoptosis in various tumor cell lines. Additionally, 4-Methyldaphnetin acts as a free radical scavenger, effectively reducing oxidative stress, and demonstrating a potent inhibitory effect on membrane lipid peroxidation. These characteristics highlight its potential therapeutic applications in cancer treatment and oxidative stress-related conditions.
CAS Number | 2107-77-9 |
Molecular Formula | C10H8O4 |
Purity | ≥95% |
Target | Apoptosis |
Storage | 2-8°C |
IUPAC Name | 7,8-dihydroxy-4-methylchromen-2-one |
InChI | InChI=1S/C10H8O4/c1-5-4-8(12)14-10-6(5)2-3-7(11)9(10)13/h2-4,11,13H,1H3 |
InChIKey | NWQBYMPNIJXFNQ-UHFFFAOYSA-N |
SMILES | CC1=CC(=O)OC2=C1C=CC(=C2O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |