For research use only. Not for therapeutic Use.
4-(Methylmercapto)phenol (Cat.No:R063898) is a chemical compound with a thiol group. It is used in the synthesis of pharmaceuticals and agrochemicals, and serves as a building block in organic chemistry. Additionally, it finds applications in industries like cosmetics and as a corrosion inhibitor in some formulations.
| Catalog Number | R063898 |
| CAS Number | 1073-72-9 |
| Synonyms | p-(Methylthio)-phenol; p-Methylmercapto-phenol; 4-(Methylsulfenyl)phenol; 4-(Methylthio)phenol; 4-Hydroxyphenyl Methyl Sulfide; 4-Hydroxythioanisole; 4-Methylsulfanylphenol; Methyl 4-Hydroxyphenyl Sulfide; NSC 75840; p-(Methylthio)phenol; p-Hydroxyph |
| Molecular Formula | C7H8OS |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 4-methylsulfanylphenol |
| InChI | InChI=1S/C7H8OS/c1-9-7-4-2-6(8)3-5-7/h2-5,8H,1H3 |
| InChIKey | QASBCTGZKABPKX-UHFFFAOYSA-N |
| SMILES | CSC1=CC=C(C=C1)O |
