For research use only. Not for therapeutic Use.
4-Methylphenanthrene is a polycyclic aromatic hydrocarbon (PAH) compound with a methyl group attached to the fourth carbon of the phenanthrene ring system. It is formed during incomplete combustion processes such as fossil fuel combustion and is found in environmental samples like air, water, and soil. 4-Methylphenanthrene is of interest due to its potential toxicity and carcinogenicity.
| Catalog Number | R030731 |
| CAS Number | 832-64-4 |
| Synonyms | NSC 21046 |
| Molecular Formula | C15H12 |
| Purity | ≥95% |
| Storage | Room temperature |
| IUPAC Name | 4-methylphenanthrene |
| InChI | InChI=1S/C15H12/c1-11-5-4-7-13-10-9-12-6-2-3-8-14(12)15(11)13/h2-10H,1H3 |
| InChIKey | LOCGAKKLRVLQAM-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC2=C1C3=CC=CC=C3C=C2 |
