Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 4-Methylpiperidine-4-carboxylic acid hydrochloride
For research use only. Not for therapeutic Use.
4-Methylpiperidine-4-carboxylic acid hydrochloride (Cat.No:L031146) is a chemical compound used in organic synthesis and pharmaceutical research. Its unique structure, incorporating a piperidine ring and carboxylic acid functionality, makes it valuable for building complex molecules. It serves as a key intermediate in the creation of diverse compounds with potential pharmaceutical applications.
CAS Number | 919354-20-4 |
Molecular Formula | C7H14ClNO2 |
Purity | ≥95% |
IUPAC Name | 4-methylpiperidine-4-carboxylic acid;hydrochloride |
InChI | InChI=1S/C7H13NO2.ClH/c1-7(6(9)10)2-4-8-5-3-7;/h8H,2-5H2,1H3,(H,9,10);1H |
InChIKey | GGMOJYOORZQAFB-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |