For research use only. Not for therapeutic Use.
4-Methylquinolin-7-ol(Cat No.:L031221)is a high-purity aromatic compound widely used in pharmaceutical research and chemical synthesis. Featuring a methyl group at the 4-position and a hydroxyl group at the 7-position on a quinoline ring, this compound plays a crucial role in the development of bioactive molecules and potential therapeutic agents. Its unique chemical structure allows for versatile applications in medicinal chemistry, including the synthesis of complex organic compounds. Ideal for drug discovery and development, this compound provides precision and reliability in advanced research, ensuring effective experimental outcomes.
CAS Number | 15463-09-9 |
Molecular Formula | C10H9NO |
Purity | ≥95% |
IUPAC Name | 4-methylquinolin-7-ol |
InChI | InChI=1S/C10H9NO/c1-7-4-5-11-10-6-8(12)2-3-9(7)10/h2-6,12H,1H3 |
InChIKey | GXFFWHIKMRPHIV-UHFFFAOYSA-N |
SMILES | CC1=C2C=CC(=CC2=NC=C1)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |