For research use only. Not for therapeutic Use.
(4-(Methylsulfonyl)-2-(trifluoromethyl)phenyl)methanol(Cat No.:M031412)is an organic compound used in pharmaceutical research and organic synthesis. It features a phenyl ring with a methylsulfonyl group at the 4-position and a trifluoromethyl group at the 2-position, along with a hydroxymethyl group. This combination of functional groups provides unique reactivity, making it a valuable intermediate in the synthesis of complex molecules. The trifluoromethyl group enhances metabolic stability and bioavailability, while the methylsulfonyl group increases polarity, making this compound essential for researchers focused on drug discovery and medicinal chemistry.
CAS Number | 1215323-17-3 |
Molecular Formula | C9H9F3O3S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | [4-methylsulfonyl-2-(trifluoromethyl)phenyl]methanol |
InChI | InChI=1S/C9H9F3O3S/c1-16(14,15)7-3-2-6(5-13)8(4-7)9(10,11)12/h2-4,13H,5H2,1H3 |
InChIKey | BAAPXLLEWXTKAZ-UHFFFAOYSA-N |
SMILES | CS(=O)(=O)C1=CC(=C(C=C1)CO)C(F)(F)F |