For research use only. Not for therapeutic Use.
4-(Methylthio)benzenemethanol is an aromatic compound featuring a methylthio group and a benzyl alcohol moiety. This structure imparts unique chemical properties, making it valuable in organic synthesis and medicinal chemistry. The methylthio group enhances lipophilicity, which can improve the bioavailability of derivatives in pharmacological applications. This compound is often explored for its potential antimicrobial and antioxidant activities. Its ability to participate in various chemical reactions, such as nucleophilic substitutions and oxidation, further broadens its utility in developing bioactive molecules. Research continues to investigate the therapeutic potential of 4-(Methylthio)benzenemethanol in various biomedical contexts.
CAS Number | 3446-90-0 |
Synonyms | 4-(Hydroxymethyl)phenyl methyl Sulfide; 4-(Methylmercapto)benzyl alcohol; 4-(Methylthio)benzyl alcohol; 4-Methylsulfanylbenzyl alcohol; [4-(Methylsulfanyl)phenyl]methanol; p-(Methylthio)benzyl alcohol |
Molecular Formula | C8H10OS |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (4-methylsulfanylphenyl)methanol |
InChI | InChI=1S/C8H10OS/c1-10-8-4-2-7(6-9)3-5-8/h2-5,9H,6H2,1H3 |
InChIKey | MTXQKSQYMREAGJ-UHFFFAOYSA-N |
SMILES | CSC1=CC=C(C=C1)CO |