For research use only. Not for therapeutic Use.
4-Methylpentanoic acid (Cat No.:R019181) is a versatile building block for the synthesis of a wide range of drugs and bioactive compounds, including inhibitors and antagonists. It is also an edible spice.
| Catalog Number | R019181 |
| CAS Number | 646-07-1 |
| Synonyms | 4-Methylpentanoic Acid; 4,4-Dimethylbutanoic Acid; 4-Methylpentanoic Acid; 4-Methylvaleric Acid; Isobutylacetic Acid; Isocaproic Acid; Isohexanoic Acid; Isohexoic Acid; NSC 4126? |
| Molecular Formula | C6H12O2 |
| Purity | ≥95% |
| Target | Disease Research Fields |
| Storage | Store at +4C |
| IUPAC Name | 4-methylpentanoic acid |
| InChI | InChI=1S/C6H12O2/c1-5(2)3-4-6(7)8/h5H,3-4H2,1-2H3,(H,7,8) |
| InChIKey | FGKJLKRYENPLQH-UHFFFAOYSA-N |
| SMILES | CC(C)CCC(=O)O |
