For research use only. Not for therapeutic Use.
4-(Morpholine-4-sulfonyl)benzoyl chloride（Cat No.:L007526）, is a chemical compound featuring a benzoyl chloride group linked to a morpholine-4-sulfonyl (tosyl) group. This compound is vital in organic synthesis, serving as a reactive intermediate for various chemical transformations, including amide and ester formation. Its unique reactivity makes it valuable for pharmaceutical and agrochemical research. Chemists utilize it as a key building block in the synthesis of complex organic molecules. Its role in creating specialized compounds contributes to advancements in medicinal chemistry, enabling the development of innovative drugs and bioactive molecules for therapeutic and research purposes.
| Catalog Number | L007526 |
| CAS Number | 654682-86-7 |
| Molecular Formula | C11H12ClNO4S |
| Purity | ≥95% |
| IUPAC Name | 4-morpholin-4-ylsulfonylbenzoyl chloride |
| InChI | InChI=1S/C11H12ClNO4S/c12-11(14)9-1-3-10(4-2-9)18(15,16)13-5-7-17-8-6-13/h1-4H,5-8H2 |
| InChIKey | UKILBGHYXVLCGS-UHFFFAOYSA-N |
| SMILES | C1COCCN1S(=O)(=O)C2=CC=C(C=C2)C(=O)Cl |
