For research use only. Not for therapeutic Use.
4-Morpholinopyridine is an organic compound featuring a pyridine ring substituted with a morpholine group at the 4-position. This structural modification imparts unique electronic and steric properties, making it useful as a ligand in organometallic and coordination chemistry. The presence of both nitrogen atoms allows it to engage in hydrogen bonding and act as a basic site. It’s also a versatile intermediate in the synthesis of pharmaceuticals, agrochemicals, and materials science applications due to its chemical stability and reactivity.
| Catalog Number | L013940 |
| CAS Number | 2767-91-1 |
| Molecular Formula | C9H12N2O |
| Purity | ≥95% |
| IUPAC Name | 4-pyridin-4-ylmorpholine |
| InChI | InChI=1S/C9H12N2O/c1-3-10-4-2-9(1)11-5-7-12-8-6-11/h1-4H,5-8H2 |
| InChIKey | QJWQYVJVCXMTJP-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC=NC=C2 |
