Home
>
Chemical Reagents>Organic Building Blocks> 4-(N-(4-Methoxybenzyl)sulfamoyl)phenylboronic acid
For research use only. Not for therapeutic Use.
4-(N-(4-Methoxybenzyl)sulfamoyl)phenylboronic acid is a boronic acid derivative featuring a phenylboronic acid moiety attached to a sulfamoyl group that is further linked to a 4-methoxybenzyl substituent. This compound exhibits unique reactivity due to the boronic acid functionality, making it useful in cross-coupling reactions and as a potential ligand in drug discovery. Its sulfonamide structure may enhance its biological activity, positioning it as a candidate for pharmaceutical applications, particularly in the development of inhibitors targeting various enzymes.
CAS Number | 957060-91-2 |
Molecular Formula | C14H16BNO5S |
Purity | ≥95% |
IUPAC Name | [4-[(4-methoxyphenyl)methylsulfamoyl]phenyl]boronic acid |
InChI | InChI=1S/C14H16BNO5S/c1-21-13-6-2-11(3-7-13)10-16-22(19,20)14-8-4-12(5-9-14)15(17)18/h2-9,16-18H,10H2,1H3 |
InChIKey | AWIGPKIEHWXBDW-UHFFFAOYSA-N |
SMILES | B(C1=CC=C(C=C1)S(=O)(=O)NCC2=CC=C(C=C2)OC)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |