For research use only. Not for therapeutic Use.
4-(N-Benzyl-N-methylamino)benzaldehyde is an aromatic aldehyde characterized by a benzaldehyde group at the fourth position, with a benzyl and a methylamino group attached to the nitrogen. This compound exhibits notable reactivity due to the aldehyde functional group, making it useful in various organic synthesis applications. Its unique structure can lead to potential biological activities, and it may serve as a precursor for the development of pharmaceuticals and fine chemicals. Additionally, it provides opportunities for exploring structure-activity relationships in medicinal chemistry.
CAS Number | 1215-41-4 |
Molecular Formula | C15H15NO |
Purity | ≥95% |
IUPAC Name | 4-[benzyl(methyl)amino]benzaldehyde |
InChI | InChI=1S/C15H15NO/c1-16(11-13-5-3-2-4-6-13)15-9-7-14(12-17)8-10-15/h2-10,12H,11H2,1H3 |
InChIKey | GIKGOYYFLICJFL-UHFFFAOYSA-N |
SMILES | CN(CC1=CC=CC=C1)C2=CC=C(C=C2)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |