For research use only. Not for therapeutic Use.
4-N-Boc-Amino-3-fluorophenylboronic acid(Cat No.:L026260)is a high-purity boronic acid derivative used extensively in pharmaceutical research and organic synthesis. Featuring a Boc-protected amino group and a fluorine atom on the phenyl ring, this compound is crucial for Suzuki-Miyaura cross-coupling reactions, enabling the construction of complex molecules. Its unique structure makes it valuable for developing biologically active compounds, particularly in the synthesis of pharmaceuticals and fine chemicals. 4-N-Boc-Amino-3-fluorophenylboronic acid offers reliable performance and consistency, ensuring successful outcomes in advanced synthetic applications.
CAS Number | 218301-87-2 |
Molecular Formula | C11H15BFNO4 |
Purity | ≥95% |
IUPAC Name | [3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
InChI | InChI=1S/C11H15BFNO4/c1-11(2,3)18-10(15)14-9-5-4-7(12(16)17)6-8(9)13/h4-6,16-17H,1-3H3,(H,14,15) |
InChIKey | KZDXWWVPJSNDSD-UHFFFAOYSA-N |
SMILES | B(C1=CC(=C(C=C1)NC(=O)OC(C)(C)C)F)(O)O |