For research use only. Not for therapeutic Use.
4-(N-Boc-N-methylamino)cyclohexanol(Cat No.:L033129)is a high-purity compound widely used in pharmaceutical research and organic synthesis. Featuring a Boc (tert-butyloxycarbonyl) protecting group, this cyclohexanol derivative is crucial for selective modifications in the synthesis of complex molecules. Its structure allows for versatile applications in medicinal chemistry, particularly in the development of new drug candidates. 4-(N-Boc-N-methylamino)cyclohexanol is ideal for advanced research, offering reliable performance in creating bioactive compounds and optimizing synthetic routes for pharmaceutical development.
CAS Number | 400899-99-2 |
Molecular Formula | C12H23NO3 |
Purity | ≥95% |
IUPAC Name | tert-butyl N-(4-hydroxycyclohexyl)-N-methylcarbamate |
InChI | InChI=1S/C12H23NO3/c1-12(2,3)16-11(15)13(4)9-5-7-10(14)8-6-9/h9-10,14H,5-8H2,1-4H3 |
InChIKey | UJHKURDWYJBHPD-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)N(C)C1CCC(CC1)O |