For research use only. Not for therapeutic Use.
4-N-Methylpyridine-3,4-diamine(Cat No.:M120760)is a versatile compound used in pharmaceutical research and organic synthesis. Featuring a pyridine ring with both a methylated amino group at the 4-position and an additional amino group at the 3-position, this compound is essential for developing various bioactive molecules, including potential drug candidates. Its structure allows for selective reactivity, making it valuable in the synthesis of complex heterocyclic compounds. High purity and consistent quality ensure reliable performance in medicinal chemistry, supporting advanced research in drug discovery and the development of innovative therapeutic agents.
CAS Number | 1839-17-4 |
Molecular Formula | C6H9N3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-N-methylpyridine-3,4-diamine |
InChI | InChI=1S/C6H9N3/c1-8-6-2-3-9-4-5(6)7/h2-4H,7H2,1H3,(H,8,9) |
InChIKey | CACZIDDDEFIYTF-UHFFFAOYSA-N |
SMILES | CNC1=C(C=NC=C1)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |