For research use only. Not for therapeutic Use.
4-N-Pentylphenol-2,3,5,6-d4, OD(Cat No.:M109135 ) is a deuterated version of 4-N-Pentylphenol, where four hydrogen atoms are replaced with deuterium and it contains an additional deuteroxyl group (OD). This isotopic labeling enhances the compound’s stability and reliability in analytical applications, making it invaluable for studying environmental pollutants and their degradation. It is particularly useful in trace analysis and environmental monitoring, helping to understand the fate and behavior of phenolic compounds in ecosystems. The enhanced properties of 4-N-Pentylphenol-d4, OD facilitate precise and detailed research in environmental chemistry and toxicology.
CAS Number | 126839-95-0 |
Molecular Formula | C11H16O |
Purity | ≥95% |
Storage | Desiccate at -20C |
IUPAC Name | 1,2,4,5-tetradeuterio-3-deuteriooxy-6-pentylbenzene |
InChI | InChI=1S/C11H16O/c1-2-3-4-5-10-6-8-11(12)9-7-10/h6-9,12H,2-5H2,1H3/i6D,7D,8D,9D/hD |
InChIKey | ZNPSUQQXTRRSBM-WLWDFMJJSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1CCCCC)[2H])[2H])O[2H])[2H] |