For research use only. Not for therapeutic Use.
4-Nitro-1H-pyrazole-3-carbonitrile(CAT: L013933) is a high-purity heterocyclic compound featuring a nitro group at the 4-position and a cyano group at the 3-position of a pyrazole ring. This versatile molecule is widely used in pharmaceutical and organic synthesis, serving as an intermediate in the development of bioactive compounds such as enzyme inhibitors, anticancer agents, and other therapeutic molecules. Its unique combination of electron-withdrawing groups makes it suitable for advanced chemical transformations, including nucleophilic substitution and cross-coupling reactions. 4-Nitro-1H-pyrazole-3-carbonitrile is an essential building block for research in medicinal chemistry, fine chemical production, and material science.
CAS Number | 61241-07-4 |
Molecular Formula | C4H2N4O2 |
Purity | ≥95% |
IUPAC Name | 4-nitro-1H-pyrazole-5-carbonitrile |
InChI | InChI=1S/C4H2N4O2/c5-1-3-4(8(9)10)2-6-7-3/h2H,(H,6,7) |
InChIKey | BLSWMOIYTDLKTA-UHFFFAOYSA-N |
SMILES | C1=NNC(=C1[N+](=O)[O-])C#N |