For research use only. Not for therapeutic Use.
4-Nitro-2-trifluoromethylphenol is an aromatic compound featuring a nitro group and a trifluoromethyl group on a phenol ring. It is often used as an intermediate in the synthesis of various chemicals and pharmaceuticals. The presence of both the electron-withdrawing nitro and trifluoromethyl groups enhances its reactivity, making it valuable for creating bioactive molecules. Its versatile structure allows for further modifications, supporting advancements in organic synthesis and medicinal chemistry in a gentle, controlled manner.
CAS Number | 1548-61-4 |
Molecular Formula | C7H4F3NO3 |
Purity | ≥95% |
Storage | -20°C |
InChI | InChI=1S/C7H4F3NO3/c8-7(9,10)5-3-4(11(13)14)1-2-6(5)12/h1-3,12H |
InChIKey | GWGZFNRFNIXCGH-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(F)(F)F)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |