For research use only. Not for therapeutic Use.
4-Nitro-α,α,α-Trifluorotoluene-d4 is a deuterated analog of 4-nitro-α,α,α-trifluorotoluene, featuring four deuterium atoms. This isotopically labeled compound is widely used in chemical research, particularly in studies involving reaction mechanisms, isotope effects, and environmental fate analyses. The deuterium atoms provide enhanced sensitivity and accuracy in NMR spectroscopy and mass spectrometry, making it easier to track and analyze the compound in complex mixtures. 4-Nitro-α,α,α-Trifluorotoluene-d4 is essential for researchers working on fluorinated aromatic compounds, offering reliable data in studies focused on drug development, agrochemicals, and materials science. Its high purity and stability ensure consistent results in various analytical and experimental applications.
CAS Number | 1219804-05-3 |
Synonyms | 4-NITRO-A,A,A-TRIFLUOROTOLUENE-D4 |
Molecular Formula | C7H4F3NO2 |
Purity | ≥95% |
Storage | Store at +4C |
IUPAC Name | 1,2,4,5-tetradeuterio-3-nitro-6-(trifluoromethyl)benzene |
InChI | InChI=1S/C7H4F3NO2/c8-7(9,10)5-1-3-6(4-2-5)11(12)13/h1-4H/i1D,2D,3D,4D |
InChIKey | XKYLCLMYQDFGKO-RHQRLBAQSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1C(F)(F)F)[2H])[2H])[N+](=O)[O-])[2H] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |