For research use only. Not for therapeutic Use.
4-Nitrobenzaldehyde is an aromatic compound with a nitro group (-NO2) and an aldehyde group (-CHO) attached to a benzene ring at the para position. It is used as an intermediate in organic synthesis for producing various compounds, including pharmaceuticals, dyes, and agrochemicals. 4-Nitrobenzaldehyde is also employed in the preparation of aromatic compounds and heterocyclic derivatives.
| Catalog Number | R062011 |
| CAS Number | 555-16-8 |
| Synonyms | 4-Formylnitrobenzene; 4-Nitrobenzenecarboxaldehyde; NSC 6103; p-Formylnitrobenzene; p-Nitrobenzaldehyde |
| Molecular Formula | C7H5NO3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-nitrobenzaldehyde |
| InChI | InChI=1S/C7H5NO3/c9-5-6-1-3-7(4-2-6)8(10)11/h1-5H |
| InChIKey | BXRFQSNOROATLV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)[N+](=O)[O-] |
